C24H22ClFN2O3S — CID 147343515
3-[3-(6-chloro-3-pyridinyl)phenyl]-1-[(2S)-1-(4-fluorophenyl)sulfonylpyrrolidin-2-yl]propan-1-one (PubChem CID 147343515) has the molecular formula C24H22ClFN2O3S and a molecular weight of 472.97 g/mol. Its IUPAC name is 3-[3-(6-chloro-3-pyridinyl)phenyl]-1-[(2S)-1-(4-fluorophenyl)sulfonylpyrrolidin-2-yl]propan-1-one.
| Compound Name | 3-[3-(6-chloro-3-pyridinyl)phenyl]-1-[(2S)-1-(4-fluorophenyl)sulfonylpyrrolidin-2-yl]propan-1-one |
|---|---|
| PubChem CID | 147343515 |
| Molecular Formula | C24H22ClFN2O3S |
| Molecular Weight | 472.97 g/mol |
| Exact Mass | 472.10 |
| IUPAC Name | 3-[3-(6-chloro-3-pyridinyl)phenyl]-1-[(2S)-1-(4-fluorophenyl)sulfonylpyrrolidin-2-yl]propan-1-one |
| SMILES | O=C(CCc1cccc(-c2ccc(Cl)nc2)c1)[C@@H]1CCCN1S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C24H22ClFN2O3S/c25-24-13-7-19(16-27-24)18-4-1-3-17(15-18)6-12-23(29)22-5-2-14-28(22)32(30,31)21-10-8-20(26)9-11-21/h1,3-4,7-11,13,15-16,22H,2,5-6,12,14H2/t22-/m0/s1 |
| InChIKey | DDZBBABMLQYKBT-QFIPXVFZSA-N |
| XLogP | 4.90 |
| TPSA | 67.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.97 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|