C19H19BrFNO3S — CID 153013264
3-(3-bromophenyl)-1-[(2S)-1-(4-fluorophenyl)sulfonylpyrrolidin-2-yl]propan-1-one (PubChem CID 153013264) has the molecular formula C19H19BrFNO3S and a molecular weight of 440.33 g/mol. Its IUPAC name is 3-(3-bromophenyl)-1-[(2S)-1-(4-fluorophenyl)sulfonylpyrrolidin-2-yl]propan-1-one.
| Compound Name | 3-(3-bromophenyl)-1-[(2S)-1-(4-fluorophenyl)sulfonylpyrrolidin-2-yl]propan-1-one |
|---|---|
| PubChem CID | 153013264 |
| Molecular Formula | C19H19BrFNO3S |
| Molecular Weight | 440.33 g/mol |
| Exact Mass | 439.03 |
| IUPAC Name | 3-(3-bromophenyl)-1-[(2S)-1-(4-fluorophenyl)sulfonylpyrrolidin-2-yl]propan-1-one |
| SMILES | O=C(CCc1cccc(Br)c1)[C@@H]1CCCN1S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H19BrFNO3S/c20-15-4-1-3-14(13-15)6-11-19(23)18-5-2-12-22(18)26(24,25)17-9-7-16(21)8-10-17/h1,3-4,7-10,13,18H,2,5-6,11-12H2/t18-/m0/s1 |
| InChIKey | VALVYJVVDCPJFE-SFHVURJKSA-N |
| XLogP | 3.94 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.33 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |