C27H30BrFN4O3S — CID 157376904
3-[6-(4-bromophenyl)-2-(butylamino)pyrimidin-4-yl]-1-[(2S)-1-(4-fluorophenyl)sulfonylpyrrolidin-2-yl]propan-1-one (PubChem CID 157376904) has the molecular formula C27H30BrFN4O3S and a molecular weight of 589.53 g/mol. Its IUPAC name is 3-[6-(4-bromophenyl)-2-(butylamino)pyrimidin-4-yl]-1-[(2S)-1-(4-fluorophenyl)sulfonylpyrrolidin-2-yl]propan-1-one.
| Compound Name | 3-[6-(4-bromophenyl)-2-(butylamino)pyrimidin-4-yl]-1-[(2S)-1-(4-fluorophenyl)sulfonylpyrrolidin-2-yl]propan-1-one |
|---|---|
| PubChem CID | 157376904 |
| Molecular Formula | C27H30BrFN4O3S |
| Molecular Weight | 589.53 g/mol |
| Exact Mass | 588.12 |
| IUPAC Name | 3-[6-(4-bromophenyl)-2-(butylamino)pyrimidin-4-yl]-1-[(2S)-1-(4-fluorophenyl)sulfonylpyrrolidin-2-yl]propan-1-one |
| SMILES | CCCCNc1nc(CCC(=O)[C@@H]2CCCN2S(=O)(=O)c2ccc(F)cc2)cc(-c2ccc(Br)cc2)n1 |
| InChI | InChI=1S/C27H30BrFN4O3S/c1-2-3-16-30-27-31-22(18-24(32-27)19-6-8-20(28)9-7-19)12-15-26(34)25-5-4-17-33(25)37(35,36)23-13-10-21(29)11-14-23/h6-11,13-14,18,25H,2-5,12,15-17H2,1H3,(H,30,31,32)/t25-/m0/s1 |
| InChIKey | BKKUECGUXARDIB-VWLOTQADSA-N |
| XLogP | 5.61 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.53 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|