C11H17NO2 — CID 14736439
1-methyl-3,4-di(propan-2-yl)pyrrole-2,5-dione (PubChem CID 14736439) has the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. Its IUPAC name is 1-methyl-3,4-di(propan-2-yl)pyrrole-2,5-dione.
| Compound Name | 1-methyl-3,4-di(propan-2-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 14736439 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | 1-methyl-3,4-di(propan-2-yl)pyrrole-2,5-dione |
| SMILES | CC(C)C1=C(C(C)C)C(=O)N(C)C1=O |
| InChI | InChI=1S/C11H17NO2/c1-6(2)8-9(7(3)4)11(14)12(5)10(8)13/h6-7H,1-5H3 |
| InChIKey | WQQPGELDKZXIHO-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|