C16H29NO — CID 20871978
1-butyl-3,4-ditert-butyl-2H-pyrrol-5-one (PubChem CID 20871978) has the molecular formula C16H29NO and a molecular weight of 251.41 g/mol. Its IUPAC name is 1-butyl-3,4-ditert-butyl-2H-pyrrol-5-one.
| Compound Name | 1-butyl-3,4-ditert-butyl-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 20871978 |
| Molecular Formula | C16H29NO |
| Molecular Weight | 251.41 g/mol |
| Exact Mass | 251.22 |
| IUPAC Name | 1-butyl-3,4-ditert-butyl-2H-pyrrol-5-one |
| SMILES | CCCCN1CC(C(C)(C)C)=C(C(C)(C)C)C1=O |
| InChI | InChI=1S/C16H29NO/c1-8-9-10-17-11-12(15(2,3)4)13(14(17)18)16(5,6)7/h8-11H2,1-7H3 |
| InChIKey | RAMLMCLAMKVPNG-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.41 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |