C17H31NO — CID 20871987
1-butyl-3,4-ditert-butyl-2,5-dihydropyridin-6-one (PubChem CID 20871987) has the molecular formula C17H31NO and a molecular weight of 265.44 g/mol. Its IUPAC name is 1-butyl-3,4-ditert-butyl-2,5-dihydropyridin-6-one.
| Compound Name | 1-butyl-3,4-ditert-butyl-2,5-dihydropyridin-6-one |
|---|---|
| PubChem CID | 20871987 |
| Molecular Formula | C17H31NO |
| Molecular Weight | 265.44 g/mol |
| Exact Mass | 265.24 |
| IUPAC Name | 1-butyl-3,4-ditert-butyl-2,5-dihydropyridin-6-one |
| SMILES | CCCCN1CC(C(C)(C)C)=C(C(C)(C)C)CC1=O |
| InChI | InChI=1S/C17H31NO/c1-8-9-10-18-12-14(17(5,6)7)13(11-15(18)19)16(2,3)4/h8-12H2,1-7H3 |
| InChIKey | VNDBPOREMPBKIO-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.44 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|