C16H27NO2 — CID 23552363
4,5-ditert-butyl-1-propyl-3H-pyridine-2,6-dione (PubChem CID 23552363) has the molecular formula C16H27NO2 and a molecular weight of 265.40 g/mol. Its IUPAC name is 4,5-ditert-butyl-1-propyl-3H-pyridine-2,6-dione.
| Compound Name | 4,5-ditert-butyl-1-propyl-3H-pyridine-2,6-dione |
|---|---|
| PubChem CID | 23552363 |
| Molecular Formula | C16H27NO2 |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.20 |
| IUPAC Name | 4,5-ditert-butyl-1-propyl-3H-pyridine-2,6-dione |
| SMILES | CCCN1C(=O)CC(C(C)(C)C)=C(C(C)(C)C)C1=O |
| InChI | InChI=1S/C16H27NO2/c1-8-9-17-12(18)10-11(15(2,3)4)13(14(17)19)16(5,6)7/h8-10H2,1-7H3 |
| InChIKey | IIDQIZIRSUCBRP-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|