C18H33NO — CID 20871979
1-butyl-5,6-ditert-butyl-3,4-dihydro-2H-azepin-7-one (PubChem CID 20871979) has the molecular formula C18H33NO and a molecular weight of 279.47 g/mol. Its IUPAC name is 1-butyl-5,6-ditert-butyl-3,4-dihydro-2H-azepin-7-one.
| Compound Name | 1-butyl-5,6-ditert-butyl-3,4-dihydro-2H-azepin-7-one |
|---|---|
| PubChem CID | 20871979 |
| Molecular Formula | C18H33NO |
| Molecular Weight | 279.47 g/mol |
| Exact Mass | 279.26 |
| IUPAC Name | 1-butyl-5,6-ditert-butyl-3,4-dihydro-2H-azepin-7-one |
| SMILES | CCCCN1CCCC(C(C)(C)C)=C(C(C)(C)C)C1=O |
| InChI | InChI=1S/C18H33NO/c1-8-9-12-19-13-10-11-14(17(2,3)4)15(16(19)20)18(5,6)7/h8-13H2,1-7H3 |
| InChIKey | VRFPDSGOZRWFGD-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.47 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |