C18H33NO — CID 23552340
3,4-ditert-butyl-1-methyl-6-propyl-5,6-dihydro-2H-azepin-7-one (PubChem CID 23552340) has the molecular formula C18H33NO and a molecular weight of 279.47 g/mol. Its IUPAC name is 3,4-ditert-butyl-1-methyl-6-propyl-5,6-dihydro-2H-azepin-7-one.
| Compound Name | 3,4-ditert-butyl-1-methyl-6-propyl-5,6-dihydro-2H-azepin-7-one |
|---|---|
| PubChem CID | 23552340 |
| Molecular Formula | C18H33NO |
| Molecular Weight | 279.47 g/mol |
| Exact Mass | 279.26 |
| IUPAC Name | 3,4-ditert-butyl-1-methyl-6-propyl-5,6-dihydro-2H-azepin-7-one |
| SMILES | CCCC1CC(C(C)(C)C)=C(C(C)(C)C)CN(C)C1=O |
| InChI | InChI=1S/C18H33NO/c1-9-10-13-11-14(17(2,3)4)15(18(5,6)7)12-19(8)16(13)20/h13H,9-12H2,1-8H3 |
| InChIKey | NVOMCNNFEPBUQW-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.47 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|