C19H33NO2 — CID 20872075
6-butyl-3,4-ditert-butyl-1-methyl-2H-azepine-5,7-dione (PubChem CID 20872075) has the molecular formula C19H33NO2 and a molecular weight of 307.48 g/mol. Its IUPAC name is 6-butyl-3,4-ditert-butyl-1-methyl-2H-azepine-5,7-dione.
| Compound Name | 6-butyl-3,4-ditert-butyl-1-methyl-2H-azepine-5,7-dione |
|---|---|
| PubChem CID | 20872075 |
| Molecular Formula | C19H33NO2 |
| Molecular Weight | 307.48 g/mol |
| Exact Mass | 307.25 |
| IUPAC Name | 6-butyl-3,4-ditert-butyl-1-methyl-2H-azepine-5,7-dione |
| SMILES | CCCCC1C(=O)C(C(C)(C)C)=C(C(C)(C)C)CN(C)C1=O |
| InChI | InChI=1S/C19H33NO2/c1-9-10-11-13-16(21)15(19(5,6)7)14(18(2,3)4)12-20(8)17(13)22/h13H,9-12H2,1-8H3 |
| InChIKey | CIHCEDXBXODUKP-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.48 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|