C22H37NO3 — CID 159463761
3,4-ditert-butyl-1-(7,7-dimethyl-6-oxooctyl)pyrrole-2,5-dione (PubChem CID 159463761) has the molecular formula C22H37NO3 and a molecular weight of 363.54 g/mol. Its IUPAC name is 3,4-ditert-butyl-1-(7,7-dimethyl-6-oxooctyl)pyrrole-2,5-dione.
| Compound Name | 3,4-ditert-butyl-1-(7,7-dimethyl-6-oxooctyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 159463761 |
| Molecular Formula | C22H37NO3 |
| Molecular Weight | 363.54 g/mol |
| Exact Mass | 363.28 |
| IUPAC Name | 3,4-ditert-butyl-1-(7,7-dimethyl-6-oxooctyl)pyrrole-2,5-dione |
| SMILES | CC(C)(C)C(=O)CCCCCN1C(=O)C(C(C)(C)C)=C(C(C)(C)C)C1=O |
| InChI | InChI=1S/C22H37NO3/c1-20(2,3)15(24)13-11-10-12-14-23-18(25)16(21(4,5)6)17(19(23)26)22(7,8)9/h10-14H2,1-9H3 |
| InChIKey | LUXMQBLYHMNDGZ-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.54 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|