C30H45N3O6 — CID 163952567
N,N-bis[2-(3-tert-butyl-4-methyl-2,5-dioxopyrrol-1-yl)ethyl]-5,5-dimethyl-4-oxohexanamide (PubChem CID 163952567) has the molecular formula C30H45N3O6 and a molecular weight of 543.71 g/mol. Its IUPAC name is N,N-bis[2-(3-tert-butyl-4-methyl-2,5-dioxopyrrol-1-yl)ethyl]-5,5-dimethyl-4-oxohexanamide.
| Compound Name | N,N-bis[2-(3-tert-butyl-4-methyl-2,5-dioxopyrrol-1-yl)ethyl]-5,5-dimethyl-4-oxohexanamide |
|---|---|
| PubChem CID | 163952567 |
| Molecular Formula | C30H45N3O6 |
| Molecular Weight | 543.71 g/mol |
| Exact Mass | 543.33 |
| IUPAC Name | N,N-bis[2-(3-tert-butyl-4-methyl-2,5-dioxopyrrol-1-yl)ethyl]-5,5-dimethyl-4-oxohexanamide |
| SMILES | CC1=C(C(C)(C)C)C(=O)N(CCN(CCN2C(=O)C(C)=C(C(C)(C)C)C2=O)C(=O)CCC(=O)C(C)(C)C)C1=O |
| InChI | InChI=1S/C30H45N3O6/c1-18-22(29(6,7)8)26(38)32(24(18)36)16-14-31(21(35)13-12-20(34)28(3,4)5)15-17-33-25(37)19(2)23(27(33)39)30(9,10)11/h12-17H2,1-11H3 |
| InChIKey | YSZPVQVCQKZBKP-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 112.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.71 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|