C17H29NO2 — CID 23552343
5,6-ditert-butyl-1-methyl-3-propylpyridine-2,4-dione (PubChem CID 23552343) has the molecular formula C17H29NO2 and a molecular weight of 279.42 g/mol. Its IUPAC name is 5,6-ditert-butyl-1-methyl-3-propylpyridine-2,4-dione.
| Compound Name | 5,6-ditert-butyl-1-methyl-3-propylpyridine-2,4-dione |
|---|---|
| PubChem CID | 23552343 |
| Molecular Formula | C17H29NO2 |
| Molecular Weight | 279.42 g/mol |
| Exact Mass | 279.22 |
| IUPAC Name | 5,6-ditert-butyl-1-methyl-3-propylpyridine-2,4-dione |
| SMILES | CCCC1C(=O)C(C(C)(C)C)=C(C(C)(C)C)N(C)C1=O |
| InChI | InChI=1S/C17H29NO2/c1-9-10-11-13(19)12(16(2,3)4)14(17(5,6)7)18(8)15(11)20/h11H,9-10H2,1-8H3 |
| InChIKey | ZFSNQVAYWPLSFB-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.42 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|