C18H31NO2 — CID 23402591
3-butyl-5,6-ditert-butyl-1-methylpyridine-2,4-dione (PubChem CID 23402591) has the molecular formula C18H31NO2 and a molecular weight of 293.45 g/mol. Its IUPAC name is 3-butyl-5,6-ditert-butyl-1-methylpyridine-2,4-dione.
| Compound Name | 3-butyl-5,6-ditert-butyl-1-methylpyridine-2,4-dione |
|---|---|
| PubChem CID | 23402591 |
| Molecular Formula | C18H31NO2 |
| Molecular Weight | 293.45 g/mol |
| Exact Mass | 293.24 |
| IUPAC Name | 3-butyl-5,6-ditert-butyl-1-methylpyridine-2,4-dione |
| SMILES | CCCCC1C(=O)C(C(C)(C)C)=C(C(C)(C)C)N(C)C1=O |
| InChI | InChI=1S/C18H31NO2/c1-9-10-11-12-14(20)13(17(2,3)4)15(18(5,6)7)19(8)16(12)21/h12H,9-11H2,1-8H3 |
| InChIKey | ILLDXMAELZCDHP-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.45 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|