C18H33NO — CID 23402617
3-butyl-5,6-ditert-butyl-1-methyl-2,3-dihydropyridin-4-one (PubChem CID 23402617) has the molecular formula C18H33NO and a molecular weight of 279.47 g/mol. Its IUPAC name is 3-butyl-5,6-ditert-butyl-1-methyl-2,3-dihydropyridin-4-one.
| Compound Name | 3-butyl-5,6-ditert-butyl-1-methyl-2,3-dihydropyridin-4-one |
|---|---|
| PubChem CID | 23402617 |
| Molecular Formula | C18H33NO |
| Molecular Weight | 279.47 g/mol |
| Exact Mass | 279.26 |
| IUPAC Name | 3-butyl-5,6-ditert-butyl-1-methyl-2,3-dihydropyridin-4-one |
| SMILES | CCCCC1CN(C)C(C(C)(C)C)=C(C(C)(C)C)C1=O |
| InChI | InChI=1S/C18H33NO/c1-9-10-11-13-12-19(8)16(18(5,6)7)14(15(13)20)17(2,3)4/h13H,9-12H2,1-8H3 |
| InChIKey | WCYHVPBOIZYWLA-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.47 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |