C19H35NO — CID 20872073
6-butyl-3,4-ditert-butyl-1-methyl-5,6-dihydro-2H-azepin-7-one (PubChem CID 20872073) has the molecular formula C19H35NO and a molecular weight of 293.50 g/mol. Its IUPAC name is 6-butyl-3,4-ditert-butyl-1-methyl-5,6-dihydro-2H-azepin-7-one.
| Compound Name | 6-butyl-3,4-ditert-butyl-1-methyl-5,6-dihydro-2H-azepin-7-one |
|---|---|
| PubChem CID | 20872073 |
| Molecular Formula | C19H35NO |
| Molecular Weight | 293.50 g/mol |
| Exact Mass | 293.27 |
| IUPAC Name | 6-butyl-3,4-ditert-butyl-1-methyl-5,6-dihydro-2H-azepin-7-one |
| SMILES | CCCCC1CC(C(C)(C)C)=C(C(C)(C)C)CN(C)C1=O |
| InChI | InChI=1S/C19H35NO/c1-9-10-11-14-12-15(18(2,3)4)16(19(5,6)7)13-20(8)17(14)21/h14H,9-13H2,1-8H3 |
| InChIKey | ULINCCJFVPSIAN-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.50 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|