C16H29NO — CID 23552370
3,4-ditert-butyl-1-propyl-2,5-dihydropyridin-6-one (PubChem CID 23552370) has the molecular formula C16H29NO and a molecular weight of 251.41 g/mol. Its IUPAC name is 3,4-ditert-butyl-1-propyl-2,5-dihydropyridin-6-one.
| Compound Name | 3,4-ditert-butyl-1-propyl-2,5-dihydropyridin-6-one |
|---|---|
| PubChem CID | 23552370 |
| Molecular Formula | C16H29NO |
| Molecular Weight | 251.41 g/mol |
| Exact Mass | 251.22 |
| IUPAC Name | 3,4-ditert-butyl-1-propyl-2,5-dihydropyridin-6-one |
| SMILES | CCCN1CC(C(C)(C)C)=C(C(C)(C)C)CC1=O |
| InChI | InChI=1S/C16H29NO/c1-8-9-17-11-13(16(5,6)7)12(10-14(17)18)15(2,3)4/h8-11H2,1-7H3 |
| InChIKey | VMZLCEVLDGHJLI-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.41 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|