C31H33F2N3O4 — CID 147366201
benzyl 6-[8-[(2,6-difluorophenyl)methoxy]-2,6-dimethylimidazo[1,2-a]pyrazin-3-yl]-3-methyl-6-oxo-3-(2,2,2-trideuterioethyl)hexanoate (PubChem CID 147366201) has the molecular formula C31H33F2N3O4 and a molecular weight of 552.64 g/mol. Its IUPAC name is benzyl 6-[8-[(2,6-difluorophenyl)methoxy]-2,6-dimethylimidazo[1,2-a]pyrazin-3-yl]-3-methyl-6-oxo-3-(2,2,2-trideuterioethyl)hexanoate.
| Compound Name | benzyl 6-[8-[(2,6-difluorophenyl)methoxy]-2,6-dimethylimidazo[1,2-a]pyrazin-3-yl]-3-methyl-6-oxo-3-(2,2,2-trideuterioethyl)hexanoate |
|---|---|
| PubChem CID | 147366201 |
| Molecular Formula | C31H33F2N3O4 |
| Molecular Weight | 552.64 g/mol |
| Exact Mass | 552.26 |
| IUPAC Name | benzyl 6-[8-[(2,6-difluorophenyl)methoxy]-2,6-dimethylimidazo[1,2-a]pyrazin-3-yl]-3-methyl-6-oxo-3-(2,2,2-trideuterioethyl)hexanoate |
| SMILES | [2H]C([2H])([2H])CC(C)(CCC(=O)c1c(C)nc2c(OCc3c(F)cccc3F)nc(C)cn12)CC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C31H33F2N3O4/c1-5-31(4,16-27(38)39-18-22-10-7-6-8-11-22)15-14-26(37)28-21(3)35-29-30(34-20(2)17-36(28)29)40-19-23-24(32)12-9-13-25(23)33/h6-13,17H,5,14-16,18-19H2,1-4H3/i1D3 |
| InChIKey | DIFIREWUXXXRJF-FIBGUPNXSA-N |
| XLogP | 6.72 |
| TPSA | 82.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.64 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |