C24H30Cl2N7+ — CID 147373835
(Z)-3-[butyl-(2,6-dichloro-4-pyridinyl)amino]-3-[(1,3-dimethyl-4-propan-2-yl-2H-pyrazolo[3,4-b]pyridin-1-ium-6-yl)methylamino]prop-2-enenitrile (PubChem CID 147373835) has the molecular formula C24H30Cl2N7+ and a molecular weight of 487.46 g/mol. Its IUPAC name is (Z)-3-[butyl-(2,6-dichloro-4-pyridinyl)amino]-3-[(1,3-dimethyl-4-propan-2-yl-2H-pyrazolo[3,4-b]pyridin-1-ium-6-yl)methylamino]prop-2-enenitrile.
| Compound Name | (Z)-3-[butyl-(2,6-dichloro-4-pyridinyl)amino]-3-[(1,3-dimethyl-4-propan-2-yl-2H-pyrazolo[3,4-b]pyridin-1-ium-6-yl)methylamino]prop-2-enenitrile |
|---|---|
| PubChem CID | 147373835 |
| Molecular Formula | C24H30Cl2N7+ |
| Molecular Weight | 487.46 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | (Z)-3-[butyl-(2,6-dichloro-4-pyridinyl)amino]-3-[(1,3-dimethyl-4-propan-2-yl-2H-pyrazolo[3,4-b]pyridin-1-ium-6-yl)methylamino]prop-2-enenitrile |
| SMILES | CCCCN(/C(=C\C#N)NCc1cc(C(C)C)c2c(C)[nH][n+](C)c2n1)c1cc(Cl)nc(Cl)c1 |
| InChI | InChI=1S/C24H29Cl2N7/c1-6-7-10-33(18-12-20(25)30-21(26)13-18)22(8-9-27)28-14-17-11-19(15(2)3)23-16(4)31-32(5)24(23)29-17/h8,11-13,15,28H,6-7,10,14H2,1-5H3/p+1/b22-8- |
| InChIKey | DJPWAFXXZMUOJA-UYOCIXKTSA-O |
| XLogP | 5.28 |
| TPSA | 84.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.46 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|