C28H24F2N6O3S — CID 147377993
(3S)-3-[[5-[2-(2,2-difluorocyclopropyl)-5-morpholin-4-yl-1,3-thiazol-4-yl]-1,3,4-oxadiazol-2-yl]amino]-1-phenyl-3,5-dihydro-2-benzazepin-4-one (PubChem CID 147377993) has the molecular formula C28H24F2N6O3S and a molecular weight of 562.60 g/mol. Its IUPAC name is (3S)-3-[[5-[2-(2,2-difluorocyclopropyl)-5-morpholin-4-yl-1,3-thiazol-4-yl]-1,3,4-oxadiazol-2-yl]amino]-1-phenyl-3,5-dihydro-2-benzazepin-4-one.
| Compound Name | (3S)-3-[[5-[2-(2,2-difluorocyclopropyl)-5-morpholin-4-yl-1,3-thiazol-4-yl]-1,3,4-oxadiazol-2-yl]amino]-1-phenyl-3,5-dihydro-2-benzazepin-4-one |
|---|---|
| PubChem CID | 147377993 |
| Molecular Formula | C28H24F2N6O3S |
| Molecular Weight | 562.60 g/mol |
| Exact Mass | 562.16 |
| IUPAC Name | (3S)-3-[[5-[2-(2,2-difluorocyclopropyl)-5-morpholin-4-yl-1,3-thiazol-4-yl]-1,3,4-oxadiazol-2-yl]amino]-1-phenyl-3,5-dihydro-2-benzazepin-4-one |
| SMILES | O=C1Cc2ccccc2C(c2ccccc2)=N[C@@H]1Nc1nnc(-c2nc(C3CC3(F)F)sc2N2CCOCC2)o1 |
| InChI | InChI=1S/C28H24F2N6O3S/c29-28(30)15-19(28)25-32-22(26(40-25)36-10-12-38-13-11-36)24-34-35-27(39-24)33-23-20(37)14-17-8-4-5-9-18(17)21(31-23)16-6-2-1-3-7-16/h1-9,19,23H,10-15H2,(H,33,35)/t19?,23-/m1/s1 |
| InChIKey | DKJZKYVPWLRDPE-LEQGEALCSA-N |
| XLogP | 4.55 |
| TPSA | 105.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.60 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |