C13H22O2S2 — CID 14738016
1-[(2R)-1-oxo-2-[(E)-prop-1-enyl]-1,3-dithian-2-yl]cyclohexan-1-ol (PubChem CID 14738016) has the molecular formula C13H22O2S2 and a molecular weight of 274.45 g/mol. Its IUPAC name is 1-[(2R)-1-oxo-2-[(E)-prop-1-enyl]-1,3-dithian-2-yl]cyclohexan-1-ol.
| Compound Name | 1-[(2R)-1-oxo-2-[(E)-prop-1-enyl]-1,3-dithian-2-yl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 14738016 |
| Molecular Formula | C13H22O2S2 |
| Molecular Weight | 274.45 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 1-[(2R)-1-oxo-2-[(E)-prop-1-enyl]-1,3-dithian-2-yl]cyclohexan-1-ol |
| SMILES | C/C=C/[C@@]1(C2(O)CCCCC2)SCCCS1=O |
| InChI | InChI=1S/C13H22O2S2/c1-2-7-13(16-10-6-11-17(13)15)12(14)8-4-3-5-9-12/h2,7,14H,3-6,8-11H2,1H3/b7-2+/t13-,17?/m1/s1 |
| InChIKey | YKFJKZAITMQJQK-BQOMURGASA-N |
| XLogP | 2.84 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.45 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|