C13H20O2S2 — CID 14738024
1-[(1E)-1-(1-oxo-1,3-dithian-2-ylidene)propan-2-yl]cyclohex-2-en-1-ol (PubChem CID 14738024) has the molecular formula C13H20O2S2 and a molecular weight of 272.44 g/mol. Its IUPAC name is 1-[(1E)-1-(1-oxo-1,3-dithian-2-ylidene)propan-2-yl]cyclohex-2-en-1-ol.
| Compound Name | 1-[(1E)-1-(1-oxo-1,3-dithian-2-ylidene)propan-2-yl]cyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 14738024 |
| Molecular Formula | C13H20O2S2 |
| Molecular Weight | 272.44 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | 1-[(1E)-1-(1-oxo-1,3-dithian-2-ylidene)propan-2-yl]cyclohex-2-en-1-ol |
| SMILES | CC(/C=C1\SCCCS1=O)C1(O)C=CCCC1 |
| InChI | InChI=1S/C13H20O2S2/c1-11(13(14)6-3-2-4-7-13)10-12-16-8-5-9-17(12)15/h3,6,10-11,14H,2,4-5,7-9H2,1H3/b12-10+ |
| InChIKey | RVOXVOFZRVKHHI-ZRDIBKRKSA-N |
| XLogP | 2.82 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.44 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|