C31H26F6N4O2 — CID 147395856
5-[2-[(2R)-1-(3,5-difluorophenyl)-4-oxo-5-[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]pentan-2-yl]-3-pyridinyl]-2-fluorobenzamide (PubChem CID 147395856) has the molecular formula C31H26F6N4O2 and a molecular weight of 600.56 g/mol. Its IUPAC name is 5-[2-[(2R)-1-(3,5-difluorophenyl)-4-oxo-5-[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]pentan-2-yl]-3-pyridinyl]-2-fluorobenzamide.
| Compound Name | 5-[2-[(2R)-1-(3,5-difluorophenyl)-4-oxo-5-[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]pentan-2-yl]-3-pyridinyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 147395856 |
| Molecular Formula | C31H26F6N4O2 |
| Molecular Weight | 600.56 g/mol |
| Exact Mass | 600.20 |
| IUPAC Name | 5-[2-[(2R)-1-(3,5-difluorophenyl)-4-oxo-5-[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]pentan-2-yl]-3-pyridinyl]-2-fluorobenzamide |
| SMILES | NC(=O)c1cc(-c2cccnc2[C@@H](CC(=O)Cn2nc(C(F)(F)F)c3c2CCCC3)Cc2cc(F)cc(F)c2)ccc1F |
| InChI | InChI=1S/C31H26F6N4O2/c32-20-11-17(12-21(33)15-20)10-19(28-23(5-3-9-39-28)18-7-8-26(34)25(14-18)30(38)43)13-22(42)16-41-27-6-2-1-4-24(27)29(40-41)31(35,36)37/h3,5,7-9,11-12,14-15,19H,1-2,4,6,10,13,16H2,(H2,38,43)/t19-/m1/s1 |
| InChIKey | DNTRFGSBQTWEQN-LJQANCHMSA-N |
| XLogP | 6.34 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.56 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |