C8H15N — CID 147395986
3,5-dimethylhex-5-en-2-imine (PubChem CID 147395986) has the molecular formula C8H15N and a molecular weight of 125.21 g/mol. Its IUPAC name is 3,5-dimethylhex-5-en-2-imine.
| Compound Name | 3,5-dimethylhex-5-en-2-imine |
|---|---|
| PubChem CID | 147395986 |
| Molecular Formula | C8H15N |
| Molecular Weight | 125.21 g/mol |
| Exact Mass | 125.12 |
| IUPAC Name | 3,5-dimethylhex-5-en-2-imine |
| SMILES | [H]/N=C(\C)C(C)CC(=C)C |
| InChI | InChI=1S/C8H15N/c1-6(2)5-7(3)8(4)9/h7,9H,1,5H2,2-4H3/b9-8+ |
| InChIKey | DNUHUBAPRHTWRN-CMDGGOBGSA-N |
| XLogP | 2.63 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.21 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|