C26H24FN11O2 — CID 147398729
1-[(1S,4S,7R,8R)-7,8-dimethyl-5-(1-phenyltetrazol-5-yl)-2,5-diazabicyclo[2.2.2]octan-2-yl]-2-[4-fluoro-7-(triazol-1-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]ethane-1,2-dione (PubChem CID 147398729) has the molecular formula C26H24FN11O2 and a molecular weight of 541.55 g/mol. Its IUPAC name is 1-[(1S,4S,7R,8R)-7,8-dimethyl-5-(1-phenyltetrazol-5-yl)-2,5-diazabicyclo[2.2.2]octan-2-yl]-2-[4-fluoro-7-(triazol-1-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]ethane-1,2-dione.
| Compound Name | 1-[(1S,4S,7R,8R)-7,8-dimethyl-5-(1-phenyltetrazol-5-yl)-2,5-diazabicyclo[2.2.2]octan-2-yl]-2-[4-fluoro-7-(triazol-1-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]ethane-1,2-dione |
|---|---|
| PubChem CID | 147398729 |
| Molecular Formula | C26H24FN11O2 |
| Molecular Weight | 541.55 g/mol |
| Exact Mass | 541.21 |
| IUPAC Name | 1-[(1S,4S,7R,8R)-7,8-dimethyl-5-(1-phenyltetrazol-5-yl)-2,5-diazabicyclo[2.2.2]octan-2-yl]-2-[4-fluoro-7-(triazol-1-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]ethane-1,2-dione |
| SMILES | C[C@@H]1[C@@H](C)[C@H]2CN(C(=O)C(=O)c3c[nH]c4c(-n5ccnn5)ncc(F)c34)[C@@H]1CN2c1nnnn1-c1ccccc1 |
| InChI | InChI=1S/C26H24FN11O2/c1-14-15(2)20-12-35(19(14)13-36(20)26-31-32-34-38(26)16-6-4-3-5-7-16)25(40)23(39)17-10-28-22-21(17)18(27)11-29-24(22)37-9-8-30-33-37/h3-11,14-15,19-20,28H,12-13H2,1-2H3/t14-,15-,19-,20-/m1/s1 |
| InChIKey | DOHYXBHFEYTPCR-PBGAUENZSA-N |
| XLogP | 1.81 |
| TPSA | 143.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.55 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|