methyl 6-amino-7,7-dimethylbicyclo[4.1.0]heptane-2-carboxylate

C11H19NO2 — CID 147403708

IUPACmethyl 6-amino-7,7-dimethylbicyclo[4.1.0]heptane-2-carboxylate
SMILESCOC(=O)C1CCCC2(N)C1C2(C)C
InChIInChI=1S/C11H19NO2/c1-10(2)8-7(9(13)14-3)5-4-6-11(8,10)12/h7-8H,4-6,12H2,1-3H3
InChIKeyDPGGCJNGDSHNRN-UHFFFAOYSA-N
MW197.28 g/mol
LogP1.31
Rot. Bonds1

About methyl 6-amino-7,7-dimethylbicyclo[4.1.0]heptane-2-carboxylate

methyl 6-amino-7,7-dimethylbicyclo[4.1.0]heptane-2-carboxylate (PubChem CID 147403708) has the molecular formula C11H19NO2 and a molecular weight of 197.28 g/mol. Its IUPAC name is methyl 6-amino-7,7-dimethylbicyclo[4.1.0]heptane-2-carboxylate.

Molecular Properties

Compound Namemethyl 6-amino-7,7-dimethylbicyclo[4.1.0]heptane-2-carboxylate
PubChem CID147403708
Molecular FormulaC11H19NO2
Molecular Weight197.28 g/mol
Exact Mass197.14
IUPAC Namemethyl 6-amino-7,7-dimethylbicyclo[4.1.0]heptane-2-carboxylate
SMILESCOC(=O)C1CCCC2(N)C1C2(C)C
InChIInChI=1S/C11H19NO2/c1-10(2)8-7(9(13)14-3)5-4-6-11(8,10)12/h7-8H,4-6,12H2,1-3H3
InChIKeyDPGGCJNGDSHNRN-UHFFFAOYSA-N
XLogP1.31
TPSA52.32 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500197.28
LogP ≤ 51.31
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze methyl 6-amino-7,7-dimethylbicyclo[4.1.0]heptane-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 6-amino-7,7-dimethylbicyclo[4.1.0]heptane-2-carboxylate?
The IUPAC name of methyl 6-amino-7,7-dimethylbicyclo[4.1.0]heptane-2-carboxylate (CID 147403708) is methyl 6-amino-7,7-dimethylbicyclo[4.1.0]heptane-2-carboxylate.
What is the SMILES notation for methyl 6-amino-7,7-dimethylbicyclo[4.1.0]heptane-2-carboxylate?
The canonical SMILES for methyl 6-amino-7,7-dimethylbicyclo[4.1.0]heptane-2-carboxylate is COC(=O)C1CCCC2(N)C1C2(C)C.
What is the InChIKey of methyl 6-amino-7,7-dimethylbicyclo[4.1.0]heptane-2-carboxylate?
The InChIKey is DPGGCJNGDSHNRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO2/c1-10(2)8-7(9(13)14-3)5-4-6-11(8,10)12/h7-8H,4-6,12H2,1-3H3.
What are the key properties of methyl 6-amino-7,7-dimethylbicyclo[4.1.0]heptane-2-carboxylate?
methyl 6-amino-7,7-dimethylbicyclo[4.1.0]heptane-2-carboxylate has a molecular weight of 197.28 g/mol, XLogP of 1.31, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-amino-7,7-dimethylbicyclo[4.1.0]heptane-2-carboxylate is sourced from PubChem (CID 147403708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).