C24H33N5 — CID 147405016
N-cyclohexyl-1-[3-[(Z)-4-iminobut-2-enimidoyl]-4a,5-dihydroquinolin-2-yl]piperidin-4-amine (PubChem CID 147405016) has the molecular formula C24H33N5 and a molecular weight of 391.56 g/mol. Its IUPAC name is N-cyclohexyl-1-[3-[(Z)-4-iminobut-2-enimidoyl]-4a,5-dihydroquinolin-2-yl]piperidin-4-amine.
| Compound Name | N-cyclohexyl-1-[3-[(Z)-4-iminobut-2-enimidoyl]-4a,5-dihydroquinolin-2-yl]piperidin-4-amine |
|---|---|
| PubChem CID | 147405016 |
| Molecular Formula | C24H33N5 |
| Molecular Weight | 391.56 g/mol |
| Exact Mass | 391.27 |
| IUPAC Name | N-cyclohexyl-1-[3-[(Z)-4-iminobut-2-enimidoyl]-4a,5-dihydroquinolin-2-yl]piperidin-4-amine |
| SMILES | [H]/N=C\C=C/C(=N\[H])C1=CC2CC=CC=C2N=C1N1CCC(NC2CCCCC2)CC1 |
| InChI | InChI=1S/C24H33N5/c25-14-6-10-22(26)21-17-18-7-4-5-11-23(18)28-24(21)29-15-12-20(13-16-29)27-19-8-2-1-3-9-19/h4-6,10-11,14,17-20,25-27H,1-3,7-9,12-13,15-16H2/b10-6-,25-14-,26-22+ |
| InChIKey | DPMPJFWVMUAJHT-QHXZQOKLSA-N |
| XLogP | 4.40 |
| TPSA | 75.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.56 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|