About triethyl-λ3-iodane
triethyl-λ3-iodane (PubChem CID 147422602) has the molecular formula C6H15I
and a molecular weight of 214.09 g/mol. Its IUPAC name is triethyl-λ3-iodane.
Molecular Properties
| Compound Name | triethyl-λ3-iodane |
| PubChem CID | 147422602 |
| Molecular Formula | C6H15I |
| Molecular Weight | 214.09 g/mol |
| Exact Mass | 214.02 |
| IUPAC Name | triethyl-λ3-iodane |
| SMILES | CCI(CC)CC |
| InChI | InChI=1S/C6H15I/c1-4-7(5-2)6-3/h4-6H2,1-3H3 |
| InChIKey | YRJOQGBNFGNRAW-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.09 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze triethyl-λ3-iodane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triethyl-λ3-iodane?
The IUPAC name of triethyl-λ3-iodane (CID 147422602) is triethyl-λ3-iodane.
What is the SMILES notation for triethyl-λ3-iodane?
The canonical SMILES for triethyl-λ3-iodane is CCI(CC)CC.
What is the InChIKey of triethyl-λ3-iodane?
The InChIKey is YRJOQGBNFGNRAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15I/c1-4-7(5-2)6-3/h4-6H2,1-3H3.
What are the key properties of triethyl-λ3-iodane?
triethyl-λ3-iodane has a molecular weight of 214.09 g/mol, XLogP of 2.55, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for triethyl-λ3-iodane is sourced from PubChem (CID 147422602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).