About ethyl(dimethyl)-λ3-iodane
ethyl(dimethyl)-λ3-iodane (PubChem CID 87059731) has the molecular formula C4H11I
and a molecular weight of 186.04 g/mol. Its IUPAC name is ethyl(dimethyl)-λ3-iodane.
Molecular Properties
| Compound Name | ethyl(dimethyl)-λ3-iodane |
| PubChem CID | 87059731 |
| Molecular Formula | C4H11I |
| Molecular Weight | 186.04 g/mol |
| Exact Mass | 185.99 |
| IUPAC Name | ethyl(dimethyl)-λ3-iodane |
| SMILES | CCI(C)C |
| InChI | InChI=1S/C4H11I/c1-4-5(2)3/h4H2,1-3H3 |
| InChIKey | KJVHRWADTYLCHI-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.04 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze ethyl(dimethyl)-λ3-iodane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl(dimethyl)-λ3-iodane?
The IUPAC name of ethyl(dimethyl)-λ3-iodane (CID 87059731) is ethyl(dimethyl)-λ3-iodane.
What is the SMILES notation for ethyl(dimethyl)-λ3-iodane?
The canonical SMILES for ethyl(dimethyl)-λ3-iodane is CCI(C)C.
What is the InChIKey of ethyl(dimethyl)-λ3-iodane?
The InChIKey is KJVHRWADTYLCHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11I/c1-4-5(2)3/h4H2,1-3H3.
What are the key properties of ethyl(dimethyl)-λ3-iodane?
ethyl(dimethyl)-λ3-iodane has a molecular weight of 186.04 g/mol, XLogP of 1.77, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl(dimethyl)-λ3-iodane is sourced from PubChem (CID 87059731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).