C11H19N3 — CID 147429113
N-(1-methylpiperidin-4-yl)-2,3-dihydropyridin-6-amine (PubChem CID 147429113) has the molecular formula C11H19N3 and a molecular weight of 193.29 g/mol. Its IUPAC name is N-(1-methylpiperidin-4-yl)-2,3-dihydropyridin-6-amine.
| Compound Name | N-(1-methylpiperidin-4-yl)-2,3-dihydropyridin-6-amine |
|---|---|
| PubChem CID | 147429113 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | N-(1-methylpiperidin-4-yl)-2,3-dihydropyridin-6-amine |
| SMILES | CN1CCC(NC2=NCCC=C2)CC1 |
| InChI | InChI=1S/C11H19N3/c1-14-8-5-10(6-9-14)13-11-4-2-3-7-12-11/h2,4,10H,3,5-9H2,1H3,(H,12,13) |
| InChIKey | DTZBCEXMTVPGJY-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |