C14H22N4 — CID 123982802
N-[cyclohexa-1,4-dien-1-yl-[4-(methylamino)piperidin-1-yl]methylidene]methanimidamide (PubChem CID 123982802) has the molecular formula C14H22N4 and a molecular weight of 246.36 g/mol. Its IUPAC name is N-[cyclohexa-1,4-dien-1-yl-[4-(methylamino)piperidin-1-yl]methylidene]methanimidamide.
| Compound Name | N-[cyclohexa-1,4-dien-1-yl-[4-(methylamino)piperidin-1-yl]methylidene]methanimidamide |
|---|---|
| PubChem CID | 123982802 |
| Molecular Formula | C14H22N4 |
| Molecular Weight | 246.36 g/mol |
| Exact Mass | 246.18 |
| IUPAC Name | N-[cyclohexa-1,4-dien-1-yl-[4-(methylamino)piperidin-1-yl]methylidene]methanimidamide |
| SMILES | [H]/N=C/N=C(\C1=CCC=CC1)N1CCC(NC)CC1 |
| InChI | InChI=1S/C14H22N4/c1-16-13-7-9-18(10-8-13)14(17-11-15)12-5-3-2-4-6-12/h2-3,6,11,13,15-16H,4-5,7-10H2,1H3/b15-11+,17-14+ |
| InChIKey | MXQNKFCUTRTXNW-WINJFPGJSA-N |
| XLogP | 1.95 |
| TPSA | 51.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.36 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|