C9H16N2 — CID 147785684
(3Z)-N-methyl-3-propylidenepiperidin-2-imine (PubChem CID 147785684) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is (3Z)-N-methyl-3-propylidenepiperidin-2-imine.
| Compound Name | (3Z)-N-methyl-3-propylidenepiperidin-2-imine |
|---|---|
| PubChem CID | 147785684 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | (3Z)-N-methyl-3-propylidenepiperidin-2-imine |
| SMILES | CC/C=C1/CCCN/C1=N\C |
| InChI | InChI=1S/C9H16N2/c1-3-5-8-6-4-7-11-9(8)10-2/h5H,3-4,6-7H2,1-2H3,(H,10,11)/b8-5- |
| InChIKey | HIQIJNJZDPORNQ-YVMONPNESA-N |
| XLogP | 1.73 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|