C10H16N2 — CID 70621009
6-prop-1-enyl-2-prop-1-en-2-yl-1,4,5,6-tetrahydropyrimidine (PubChem CID 70621009) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is 6-prop-1-enyl-2-prop-1-en-2-yl-1,4,5,6-tetrahydropyrimidine.
| Compound Name | 6-prop-1-enyl-2-prop-1-en-2-yl-1,4,5,6-tetrahydropyrimidine |
|---|---|
| PubChem CID | 70621009 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | 6-prop-1-enyl-2-prop-1-en-2-yl-1,4,5,6-tetrahydropyrimidine |
| SMILES | C=C(C)C1=NCCC(C=CC)N1 |
| InChI | InChI=1S/C10H16N2/c1-4-5-9-6-7-11-10(12-9)8(2)3/h4-5,9H,2,6-7H2,1,3H3,(H,11,12) |
| InChIKey | UWSADISFLOEQEP-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|