C11H17N5 — CID 91375004
5-methyl-6-(methylaminomethyl)-6,8a-dihydroquinazoline-2,4-diamine (PubChem CID 91375004) has the molecular formula C11H17N5 and a molecular weight of 219.29 g/mol. Its IUPAC name is 5-methyl-6-(methylaminomethyl)-6,8a-dihydroquinazoline-2,4-diamine.
| Compound Name | 5-methyl-6-(methylaminomethyl)-6,8a-dihydroquinazoline-2,4-diamine |
|---|---|
| PubChem CID | 91375004 |
| Molecular Formula | C11H17N5 |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.15 |
| IUPAC Name | 5-methyl-6-(methylaminomethyl)-6,8a-dihydroquinazoline-2,4-diamine |
| SMILES | CNCC1C=CC2N=C(N)N=C(N)C2=C1C |
| InChI | InChI=1S/C11H17N5/c1-6-7(5-14-2)3-4-8-9(6)10(12)16-11(13)15-8/h3-4,7-8,14H,5H2,1-2H3,(H4,12,13,15,16) |
| InChIKey | YLPLPAYOAKPJNU-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 88.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|