C32H50O7 — CID 147451692
(4R)-12-hydroxy-2,3-dimethoxy-4,6a,6b,11,11,14b-hexamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicene-4,8a-dicarboxylic acid (PubChem CID 147451692) has the molecular formula C32H50O7 and a molecular weight of 546.75 g/mol. Its IUPAC name is (4R)-12-hydroxy-2,3-dimethoxy-4,6a,6b,11,11,14b-hexamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicene-4,8a-dicarboxylic acid.
| Compound Name | (4R)-12-hydroxy-2,3-dimethoxy-4,6a,6b,11,11,14b-hexamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicene-4,8a-dicarboxylic acid |
|---|---|
| PubChem CID | 147451692 |
| Molecular Formula | C32H50O7 |
| Molecular Weight | 546.75 g/mol |
| Exact Mass | 546.36 |
| IUPAC Name | (4R)-12-hydroxy-2,3-dimethoxy-4,6a,6b,11,11,14b-hexamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicene-4,8a-dicarboxylic acid |
| SMILES | COC1CC2(C)C3CC=C4C5C(O)C(C)(C)CCC5(C(=O)O)CCC4(C)C3(C)CCC2[C@@](C)(C(=O)O)C1OC |
| InChI | InChI=1S/C32H50O7/c1-27(2)13-15-32(26(36)37)16-14-29(4)18(22(32)23(27)33)9-10-20-28(3)17-19(38-7)24(39-8)31(6,25(34)35)21(28)11-12-30(20,29)5/h9,19-24,33H,10-17H2,1-8H3,(H,34,35)(H,36,37)/t19?,20?,21?,22?,23?,24?,28?,29?,30?,31-,32?/m1/s1 |
| InChIKey | PCLSVASLEGHMAV-MNXLZZAISA-N |
| XLogP | 5.55 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.75 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|