C22H18F2N6OS — CID 147457486
4-[3-(2-ethyl-9-fluoro-4-oxopyrido[1,2-a]pyrimidin-7-yl)-5-imino-4,4-dimethyl-2-sulfanylideneimidazolidin-1-yl]-2-fluorobenzonitrile (PubChem CID 147457486) has the molecular formula C22H18F2N6OS and a molecular weight of 452.49 g/mol. Its IUPAC name is 4-[3-(2-ethyl-9-fluoro-4-oxopyrido[1,2-a]pyrimidin-7-yl)-5-imino-4,4-dimethyl-2-sulfanylideneimidazolidin-1-yl]-2-fluorobenzonitrile.
| Compound Name | 4-[3-(2-ethyl-9-fluoro-4-oxopyrido[1,2-a]pyrimidin-7-yl)-5-imino-4,4-dimethyl-2-sulfanylideneimidazolidin-1-yl]-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 147457486 |
| Molecular Formula | C22H18F2N6OS |
| Molecular Weight | 452.49 g/mol |
| Exact Mass | 452.12 |
| IUPAC Name | 4-[3-(2-ethyl-9-fluoro-4-oxopyrido[1,2-a]pyrimidin-7-yl)-5-imino-4,4-dimethyl-2-sulfanylideneimidazolidin-1-yl]-2-fluorobenzonitrile |
| SMILES | [H]/N=C1/N(c2ccc(C#N)c(F)c2)C(=S)N(c2cc(F)c3nc(CC)cc(=O)n3c2)C1(C)C |
| InChI | InChI=1S/C22H18F2N6OS/c1-4-13-7-18(31)28-11-15(9-17(24)19(28)27-13)30-21(32)29(20(26)22(30,2)3)14-6-5-12(10-25)16(23)8-14/h5-9,11,26H,4H2,1-3H3/b26-20+ |
| InChIKey | DZGVJQXRXDOOBO-LHLOQNFPSA-N |
| XLogP | 3.77 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.49 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|