C44H41NOSi — CID 147463518
3,6-ditert-butyl-9-(10,10-diphenylbenzo[b][1,4]benzoxasilin-2-yl)carbazole (PubChem CID 147463518) has the molecular formula C44H41NOSi and a molecular weight of 627.90 g/mol. Its IUPAC name is 3,6-ditert-butyl-9-(10,10-diphenylbenzo[b][1,4]benzoxasilin-2-yl)carbazole.
| Compound Name | 3,6-ditert-butyl-9-(10,10-diphenylbenzo[b][1,4]benzoxasilin-2-yl)carbazole |
|---|---|
| PubChem CID | 147463518 |
| Molecular Formula | C44H41NOSi |
| Molecular Weight | 627.90 g/mol |
| Exact Mass | 627.30 |
| IUPAC Name | 3,6-ditert-butyl-9-(10,10-diphenylbenzo[b][1,4]benzoxasilin-2-yl)carbazole |
| SMILES | CC(C)(C)c1ccc2c(c1)c1cc(C(C)(C)C)ccc1n2-c1ccc2c(c1)[Si](c1ccccc1)(c1ccccc1)c1ccccc1O2 |
| InChI | InChI=1S/C44H41NOSi/c1-43(2,3)30-21-24-37-35(27-30)36-28-31(44(4,5)6)22-25-38(36)45(37)32-23-26-40-42(29-32)47(33-15-9-7-10-16-33,34-17-11-8-12-18-34)41-20-14-13-19-39(41)46-40/h7-29H,1-6H3 |
| InChIKey | FAJKJYHISSGVOJ-UHFFFAOYSA-N |
| XLogP | 8.86 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.90 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|