C5H10AlN3S2 — CID 147469397
4-alumanyl-1-ethyl-2-methyl-1,2,4-triazolidine-3,5-dithione (PubChem CID 147469397) has the molecular formula C5H10AlN3S2 and a molecular weight of 203.27 g/mol. Its IUPAC name is 4-alumanyl-1-ethyl-2-methyl-1,2,4-triazolidine-3,5-dithione.
| Compound Name | 4-alumanyl-1-ethyl-2-methyl-1,2,4-triazolidine-3,5-dithione |
|---|---|
| PubChem CID | 147469397 |
| Molecular Formula | C5H10AlN3S2 |
| Molecular Weight | 203.27 g/mol |
| Exact Mass | 203.01 |
| IUPAC Name | 4-alumanyl-1-ethyl-2-methyl-1,2,4-triazolidine-3,5-dithione |
| SMILES | CCn1c(=S)n([AlH2])c(=S)n1C |
| InChI | InChI=1S/C5H9N3S2.Al.2H/c1-3-8-5(10)6-4(9)7(8)2;;;/h3H2,1-2H3,(H,6,9,10);;;/q;+1;;/p-1 |
| InChIKey | FBLRZWDXQNJAPH-UHFFFAOYSA-M |
| XLogP | 0.50 |
| TPSA | 14.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.27 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|