C10H9NO3S — CID 1474969
4-methyl-3-oxo-1,4-benzothiazine-6-carboxylic acid (PubChem CID 1474969) has the molecular formula C10H9NO3S and a molecular weight of 223.25 g/mol. Its IUPAC name is 4-methyl-3-oxo-1,4-benzothiazine-6-carboxylic acid.
| Compound Name | 4-methyl-3-oxo-1,4-benzothiazine-6-carboxylic acid |
|---|---|
| PubChem CID | 1474969 |
| Molecular Formula | C10H9NO3S |
| Molecular Weight | 223.25 g/mol |
| Exact Mass | 223.03 |
| IUPAC Name | 4-methyl-3-oxo-1,4-benzothiazine-6-carboxylic acid |
| SMILES | CN1C(=O)CSc2ccc(C(=O)O)cc21 |
| InChI | InChI=1S/C10H9NO3S/c1-11-7-4-6(10(13)14)2-3-8(7)15-5-9(11)12/h2-4H,5H2,1H3,(H,13,14) |
| InChIKey | JHMLWQWKVSDFLZ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.25 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |