C17H26F2O2 — CID 147498799
5-(4-ethenyl-3,4-difluoro-8-hydroxyoct-1-en-3-yl)bicyclo[2.2.1]heptan-2-ol (PubChem CID 147498799) has the molecular formula C17H26F2O2 and a molecular weight of 300.39 g/mol. Its IUPAC name is 5-(4-ethenyl-3,4-difluoro-8-hydroxyoct-1-en-3-yl)bicyclo[2.2.1]heptan-2-ol.
| Compound Name | 5-(4-ethenyl-3,4-difluoro-8-hydroxyoct-1-en-3-yl)bicyclo[2.2.1]heptan-2-ol |
|---|---|
| PubChem CID | 147498799 |
| Molecular Formula | C17H26F2O2 |
| Molecular Weight | 300.39 g/mol |
| Exact Mass | 300.19 |
| IUPAC Name | 5-(4-ethenyl-3,4-difluoro-8-hydroxyoct-1-en-3-yl)bicyclo[2.2.1]heptan-2-ol |
| SMILES | C=CC(F)(CCCCO)C(F)(C=C)C1CC2CC1CC2O |
| InChI | InChI=1S/C17H26F2O2/c1-3-16(18,7-5-6-8-20)17(19,4-2)14-10-13-9-12(14)11-15(13)21/h3-4,12-15,20-21H,1-2,5-11H2 |
| InChIKey | FGZXJIJNFQAXSH-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.39 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|