C31H39N3O5 — CID 147504015
(2R)-2-benzyl-N-[(2S)-7-[4-(dimethylamino)piperidin-1-yl]-3,6,7-trioxoheptan-2-yl]-4-oxo-4-phenylbutanamide (PubChem CID 147504015) has the molecular formula C31H39N3O5 and a molecular weight of 533.67 g/mol. Its IUPAC name is (2R)-2-benzyl-N-[(2S)-7-[4-(dimethylamino)piperidin-1-yl]-3,6,7-trioxoheptan-2-yl]-4-oxo-4-phenylbutanamide.
| Compound Name | (2R)-2-benzyl-N-[(2S)-7-[4-(dimethylamino)piperidin-1-yl]-3,6,7-trioxoheptan-2-yl]-4-oxo-4-phenylbutanamide |
|---|---|
| PubChem CID | 147504015 |
| Molecular Formula | C31H39N3O5 |
| Molecular Weight | 533.67 g/mol |
| Exact Mass | 533.29 |
| IUPAC Name | (2R)-2-benzyl-N-[(2S)-7-[4-(dimethylamino)piperidin-1-yl]-3,6,7-trioxoheptan-2-yl]-4-oxo-4-phenylbutanamide |
| SMILES | C[C@H](NC(=O)C(CC(=O)c1ccccc1)Cc1ccccc1)C(=O)CCC(=O)C(=O)N1CCC(N(C)C)CC1 |
| InChI | InChI=1S/C31H39N3O5/c1-22(27(35)14-15-28(36)31(39)34-18-16-26(17-19-34)33(2)3)32-30(38)25(20-23-10-6-4-7-11-23)21-29(37)24-12-8-5-9-13-24/h4-13,22,25-26H,14-21H2,1-3H3,(H,32,38)/t22-,25?/m0/s1 |
| InChIKey | FHZBBIIEGAYCSN-XADRRFQNSA-N |
| XLogP | 3.09 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.67 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|