C35H45NO5 — CID 161251890
(2R)-2-benzyl-N-[(2S,5S)-5-tert-butyl-8-cyclohexyl-3,6,7-trioxooctan-2-yl]-4-oxo-4-phenylbutanamide (PubChem CID 161251890) has the molecular formula C35H45NO5 and a molecular weight of 559.75 g/mol. Its IUPAC name is (2R)-2-benzyl-N-[(2S,5S)-5-tert-butyl-8-cyclohexyl-3,6,7-trioxooctan-2-yl]-4-oxo-4-phenylbutanamide.
| Compound Name | (2R)-2-benzyl-N-[(2S,5S)-5-tert-butyl-8-cyclohexyl-3,6,7-trioxooctan-2-yl]-4-oxo-4-phenylbutanamide |
|---|---|
| PubChem CID | 161251890 |
| Molecular Formula | C35H45NO5 |
| Molecular Weight | 559.75 g/mol |
| Exact Mass | 559.33 |
| IUPAC Name | (2R)-2-benzyl-N-[(2S,5S)-5-tert-butyl-8-cyclohexyl-3,6,7-trioxooctan-2-yl]-4-oxo-4-phenylbutanamide |
| SMILES | C[C@H](NC(=O)[C@@H](CC(=O)c1ccccc1)Cc1ccccc1)C(=O)C[C@H](C(=O)C(=O)CC1CCCCC1)C(C)(C)C |
| InChI | InChI=1S/C35H45NO5/c1-24(30(37)23-29(35(2,3)4)33(40)32(39)21-26-16-10-6-11-17-26)36-34(41)28(20-25-14-8-5-9-15-25)22-31(38)27-18-12-7-13-19-27/h5,7-9,12-15,18-19,24,26,28-29H,6,10-11,16-17,20-23H2,1-4H3,(H,36,41)/t24-,28+,29+/m0/s1 |
| InChIKey | VBJLGHAPMKOELL-TUMTZTIRSA-N |
| XLogP | 6.35 |
| TPSA | 97.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.75 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|