C34H43F2NO5 — CID 161111289
(2S)-N-[(2S,5S)-9-[4-(1,1-difluoroethyl)phenyl]-3,6,7-trioxo-5-propan-2-ylnonan-2-yl]-3,3-dimethyl-2-phenacylbutanamide (PubChem CID 161111289) has the molecular formula C34H43F2NO5 and a molecular weight of 583.72 g/mol. Its IUPAC name is (2S)-N-[(2S,5S)-9-[4-(1,1-difluoroethyl)phenyl]-3,6,7-trioxo-5-propan-2-ylnonan-2-yl]-3,3-dimethyl-2-phenacylbutanamide.
| Compound Name | (2S)-N-[(2S,5S)-9-[4-(1,1-difluoroethyl)phenyl]-3,6,7-trioxo-5-propan-2-ylnonan-2-yl]-3,3-dimethyl-2-phenacylbutanamide |
|---|---|
| PubChem CID | 161111289 |
| Molecular Formula | C34H43F2NO5 |
| Molecular Weight | 583.72 g/mol |
| Exact Mass | 583.31 |
| IUPAC Name | (2S)-N-[(2S,5S)-9-[4-(1,1-difluoroethyl)phenyl]-3,6,7-trioxo-5-propan-2-ylnonan-2-yl]-3,3-dimethyl-2-phenacylbutanamide |
| SMILES | CC(C)C(CC(=O)[C@H](C)NC(=O)[C@@H](CC(=O)c1ccccc1)C(C)(C)C)C(=O)C(=O)CCc1ccc(C(C)(F)F)cc1 |
| InChI | InChI=1S/C34H43F2NO5/c1-21(2)26(31(41)28(38)18-15-23-13-16-25(17-14-23)34(7,35)36)19-29(39)22(3)37-32(42)27(33(4,5)6)20-30(40)24-11-9-8-10-12-24/h8-14,16-17,21-22,26-27H,15,18-20H2,1-7H3,(H,37,42)/t22-,26?,27+/m0/s1 |
| InChIKey | GNWJVCXAERCDHE-GSFSFIAGSA-N |
| XLogP | 6.54 |
| TPSA | 97.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.72 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|