C29H41NO5 — CID 149495677
N-[(2S,5S)-8-cyclohexyl-3,6,7-trioxo-5-propan-2-yloctan-2-yl]-2,2-dimethyl-4-oxo-4-phenylbutanamide (PubChem CID 149495677) has the molecular formula C29H41NO5 and a molecular weight of 483.65 g/mol. Its IUPAC name is N-[(2S,5S)-8-cyclohexyl-3,6,7-trioxo-5-propan-2-yloctan-2-yl]-2,2-dimethyl-4-oxo-4-phenylbutanamide.
| Compound Name | N-[(2S,5S)-8-cyclohexyl-3,6,7-trioxo-5-propan-2-yloctan-2-yl]-2,2-dimethyl-4-oxo-4-phenylbutanamide |
|---|---|
| PubChem CID | 149495677 |
| Molecular Formula | C29H41NO5 |
| Molecular Weight | 483.65 g/mol |
| Exact Mass | 483.30 |
| IUPAC Name | N-[(2S,5S)-8-cyclohexyl-3,6,7-trioxo-5-propan-2-yloctan-2-yl]-2,2-dimethyl-4-oxo-4-phenylbutanamide |
| SMILES | CC(C)C(CC(=O)[C@H](C)NC(=O)C(C)(C)CC(=O)c1ccccc1)C(=O)C(=O)CC1CCCCC1 |
| InChI | InChI=1S/C29H41NO5/c1-19(2)23(27(34)25(32)16-21-12-8-6-9-13-21)17-24(31)20(3)30-28(35)29(4,5)18-26(33)22-14-10-7-11-15-22/h7,10-11,14-15,19-21,23H,6,8-9,12-13,16-18H2,1-5H3,(H,30,35)/t20-,23?/m0/s1 |
| InChIKey | ZFYWXQBXGHBGTL-AJZOCDQUSA-N |
| XLogP | 5.13 |
| TPSA | 97.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.65 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|