C32H46N2O6 — CID 147001363
(2S)-3,3-dimethyl-2-phenacyl-N-[(2S,5S)-3,6,7,10-tetraoxo-10-piperidin-1-yl-5-propan-2-yldecan-2-yl]butanamide (PubChem CID 147001363) has the molecular formula C32H46N2O6 and a molecular weight of 554.73 g/mol. Its IUPAC name is (2S)-3,3-dimethyl-2-phenacyl-N-[(2S,5S)-3,6,7,10-tetraoxo-10-piperidin-1-yl-5-propan-2-yldecan-2-yl]butanamide.
| Compound Name | (2S)-3,3-dimethyl-2-phenacyl-N-[(2S,5S)-3,6,7,10-tetraoxo-10-piperidin-1-yl-5-propan-2-yldecan-2-yl]butanamide |
|---|---|
| PubChem CID | 147001363 |
| Molecular Formula | C32H46N2O6 |
| Molecular Weight | 554.73 g/mol |
| Exact Mass | 554.34 |
| IUPAC Name | (2S)-3,3-dimethyl-2-phenacyl-N-[(2S,5S)-3,6,7,10-tetraoxo-10-piperidin-1-yl-5-propan-2-yldecan-2-yl]butanamide |
| SMILES | CC(C)[C@H](CC(=O)[C@H](C)NC(=O)[C@@H](CC(=O)c1ccccc1)C(C)(C)C)C(=O)C(=O)CCC(=O)N1CCCCC1 |
| InChI | InChI=1S/C32H46N2O6/c1-21(2)24(30(39)26(35)15-16-29(38)34-17-11-8-12-18-34)19-27(36)22(3)33-31(40)25(32(4,5)6)20-28(37)23-13-9-7-10-14-23/h7,9-10,13-14,21-22,24-25H,8,11-12,15-20H2,1-6H3,(H,33,40)/t22-,24-,25+/m0/s1 |
| InChIKey | ASCCQZOEXGGAKY-ZKMPZPQNSA-N |
| XLogP | 4.59 |
| TPSA | 117.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.73 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|