C34H39N3O7S — CID 147815570
(2R)-2-benzyl-4-oxo-4-pyridin-4-yl-N-[(2S,5S)-3,6,7-trioxo-5-propan-2-yl-9-(3-sulfamoylphenyl)nonan-2-yl]butanamide (PubChem CID 147815570) has the molecular formula C34H39N3O7S and a molecular weight of 633.77 g/mol. Its IUPAC name is (2R)-2-benzyl-4-oxo-4-pyridin-4-yl-N-[(2S,5S)-3,6,7-trioxo-5-propan-2-yl-9-(3-sulfamoylphenyl)nonan-2-yl]butanamide.
| Compound Name | (2R)-2-benzyl-4-oxo-4-pyridin-4-yl-N-[(2S,5S)-3,6,7-trioxo-5-propan-2-yl-9-(3-sulfamoylphenyl)nonan-2-yl]butanamide |
|---|---|
| PubChem CID | 147815570 |
| Molecular Formula | C34H39N3O7S |
| Molecular Weight | 633.77 g/mol |
| Exact Mass | 633.25 |
| IUPAC Name | (2R)-2-benzyl-4-oxo-4-pyridin-4-yl-N-[(2S,5S)-3,6,7-trioxo-5-propan-2-yl-9-(3-sulfamoylphenyl)nonan-2-yl]butanamide |
| SMILES | CC(C)C(CC(=O)[C@H](C)NC(=O)[C@@H](CC(=O)c1ccncc1)Cc1ccccc1)C(=O)C(=O)CCc1cccc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C34H39N3O7S/c1-22(2)29(33(41)30(38)13-12-25-10-7-11-28(19-25)45(35,43)44)21-31(39)23(3)37-34(42)27(18-24-8-5-4-6-9-24)20-32(40)26-14-16-36-17-15-26/h4-11,14-17,19,22-23,27,29H,12-13,18,20-21H2,1-3H3,(H,37,42)(H2,35,43,44)/t23-,27+,29?/m0/s1 |
| InChIKey | HOFRBJALLSMGRF-WVFDOEJVSA-N |
| XLogP | 3.67 |
| TPSA | 170.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.77 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|