C35H38FN3O6 — CID 157426059
5-[[3-[[2-benzyl-4-(3-fluorophenyl)-4-oxobutanoyl]amino]-2-oxobutanoyl]amino]-2,2-dimethyl-4-oxo-6-phenylhexanamide (PubChem CID 157426059) has the molecular formula C35H38FN3O6 and a molecular weight of 615.70 g/mol. Its IUPAC name is 5-[[3-[[2-benzyl-4-(3-fluorophenyl)-4-oxobutanoyl]amino]-2-oxobutanoyl]amino]-2,2-dimethyl-4-oxo-6-phenylhexanamide.
| Compound Name | 5-[[3-[[2-benzyl-4-(3-fluorophenyl)-4-oxobutanoyl]amino]-2-oxobutanoyl]amino]-2,2-dimethyl-4-oxo-6-phenylhexanamide |
|---|---|
| PubChem CID | 157426059 |
| Molecular Formula | C35H38FN3O6 |
| Molecular Weight | 615.70 g/mol |
| Exact Mass | 615.27 |
| IUPAC Name | 5-[[3-[[2-benzyl-4-(3-fluorophenyl)-4-oxobutanoyl]amino]-2-oxobutanoyl]amino]-2,2-dimethyl-4-oxo-6-phenylhexanamide |
| SMILES | CC(NC(=O)C(CC(=O)c1cccc(F)c1)Cc1ccccc1)C(=O)C(=O)NC(Cc1ccccc1)C(=O)CC(C)(C)C(N)=O |
| InChI | InChI=1S/C35H38FN3O6/c1-22(31(42)33(44)39-28(18-24-13-8-5-9-14-24)30(41)21-35(2,3)34(37)45)38-32(43)26(17-23-11-6-4-7-12-23)20-29(40)25-15-10-16-27(36)19-25/h4-16,19,22,26,28H,17-18,20-21H2,1-3H3,(H2,37,45)(H,38,43)(H,39,44) |
| InChIKey | BPYXJDWGEMOGME-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 152.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.70 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|