C47H46FN3O6 — CID 157409566
5-[[3-[(2-benzyl-4-oxo-5-phenylpentanoyl)amino]-2-oxobutanoyl]amino]-6-(2-fluorophenyl)-4-oxo-2-[(4-phenylphenyl)methyl]hexanamide (PubChem CID 157409566) has the molecular formula C47H46FN3O6 and a molecular weight of 767.90 g/mol. Its IUPAC name is 5-[[3-[(2-benzyl-4-oxo-5-phenylpentanoyl)amino]-2-oxobutanoyl]amino]-6-(2-fluorophenyl)-4-oxo-2-[(4-phenylphenyl)methyl]hexanamide.
| Compound Name | 5-[[3-[(2-benzyl-4-oxo-5-phenylpentanoyl)amino]-2-oxobutanoyl]amino]-6-(2-fluorophenyl)-4-oxo-2-[(4-phenylphenyl)methyl]hexanamide |
|---|---|
| PubChem CID | 157409566 |
| Molecular Formula | C47H46FN3O6 |
| Molecular Weight | 767.90 g/mol |
| Exact Mass | 767.34 |
| IUPAC Name | 5-[[3-[(2-benzyl-4-oxo-5-phenylpentanoyl)amino]-2-oxobutanoyl]amino]-6-(2-fluorophenyl)-4-oxo-2-[(4-phenylphenyl)methyl]hexanamide |
| SMILES | CC(NC(=O)C(CC(=O)Cc1ccccc1)Cc1ccccc1)C(=O)C(=O)NC(Cc1ccccc1F)C(=O)CC(Cc1ccc(-c2ccccc2)cc1)C(N)=O |
| InChI | InChI=1S/C47H46FN3O6/c1-31(50-46(56)39(26-32-13-5-2-6-14-32)28-40(52)27-33-15-7-3-8-16-33)44(54)47(57)51-42(29-37-19-11-12-20-41(37)48)43(53)30-38(45(49)55)25-34-21-23-36(24-22-34)35-17-9-4-10-18-35/h2-24,31,38-39,42H,25-30H2,1H3,(H2,49,55)(H,50,56)(H,51,57) |
| InChIKey | BOCQFHATSVSJHU-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 152.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.90 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|