C13H27N3O5 — CID 147510471
2-[2-[2-[2-[4-(methylamino)butan-2-yloxy]ethoxy]ethylamino]-2-oxoethoxy]acetamide (PubChem CID 147510471) has the molecular formula C13H27N3O5 and a molecular weight of 305.38 g/mol. Its IUPAC name is 2-[2-[2-[2-[4-(methylamino)butan-2-yloxy]ethoxy]ethylamino]-2-oxoethoxy]acetamide.
| Compound Name | 2-[2-[2-[2-[4-(methylamino)butan-2-yloxy]ethoxy]ethylamino]-2-oxoethoxy]acetamide |
|---|---|
| PubChem CID | 147510471 |
| Molecular Formula | C13H27N3O5 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.20 |
| IUPAC Name | 2-[2-[2-[2-[4-(methylamino)butan-2-yloxy]ethoxy]ethylamino]-2-oxoethoxy]acetamide |
| SMILES | CNCCC(C)OCCOCCNC(=O)COCC(N)=O |
| InChI | InChI=1S/C13H27N3O5/c1-11(3-4-15-2)21-8-7-19-6-5-16-13(18)10-20-9-12(14)17/h11,15H,3-10H2,1-2H3,(H2,14,17)(H,16,18) |
| InChIKey | FJEUXONTEGKVGF-UHFFFAOYSA-N |
| XLogP | -1.36 |
| TPSA | 111.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|