C22H23N3O5 — CID 147516799
4-[2-[4-(2-hydroxyethylamino)phenyl]ethynyl]-N-[4-hydroxy-1-(methylamino)-1,3-dioxobutan-2-yl]benzamide (PubChem CID 147516799) has the molecular formula C22H23N3O5 and a molecular weight of 409.44 g/mol. Its IUPAC name is 4-[2-[4-(2-hydroxyethylamino)phenyl]ethynyl]-N-[4-hydroxy-1-(methylamino)-1,3-dioxobutan-2-yl]benzamide.
| Compound Name | 4-[2-[4-(2-hydroxyethylamino)phenyl]ethynyl]-N-[4-hydroxy-1-(methylamino)-1,3-dioxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 147516799 |
| Molecular Formula | C22H23N3O5 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | 4-[2-[4-(2-hydroxyethylamino)phenyl]ethynyl]-N-[4-hydroxy-1-(methylamino)-1,3-dioxobutan-2-yl]benzamide |
| SMILES | CNC(=O)C(NC(=O)c1ccc(C#Cc2ccc(NCCO)cc2)cc1)C(=O)CO |
| InChI | InChI=1S/C22H23N3O5/c1-23-22(30)20(19(28)14-27)25-21(29)17-8-4-15(5-9-17)2-3-16-6-10-18(11-7-16)24-12-13-26/h4-11,20,24,26-27H,12-14H2,1H3,(H,23,30)(H,25,29) |
| InChIKey | FKJQFVGNDOBNMQ-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 127.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|